C17H25ClN2O3 — CID 108501268
N-(3-chloro-4-methoxyphenyl)-N',N'-bis(2-methylpropyl)oxamide (PubChem CID 108501268) has the molecular formula C17H25ClN2O3 and a molecular weight of 340.85 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-N',N'-bis(2-methylpropyl)oxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-N',N'-bis(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 108501268 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-N',N'-bis(2-methylpropyl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)N(CC(C)C)CC(C)C)cc1Cl |
| InChI | InChI=1S/C17H25ClN2O3/c1-11(2)9-20(10-12(3)4)17(22)16(21)19-13-6-7-15(23-5)14(18)8-13/h6-8,11-12H,9-10H2,1-5H3,(H,19,21) |
| InChIKey | JYRMKTOMDKPGPM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|