C19H26ClN3O2 — CID 108825995
(Z)-3-[bis(2-methylpropyl)amino]-N-(3-chloro-4-methoxyphenyl)-2-cyanoprop-2-enamide (PubChem CID 108825995) has the molecular formula C19H26ClN3O2 and a molecular weight of 363.89 g/mol. Its IUPAC name is (Z)-3-[bis(2-methylpropyl)amino]-N-(3-chloro-4-methoxyphenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[bis(2-methylpropyl)amino]-N-(3-chloro-4-methoxyphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108825995 |
| Molecular Formula | C19H26ClN3O2 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | (Z)-3-[bis(2-methylpropyl)amino]-N-(3-chloro-4-methoxyphenyl)-2-cyanoprop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C\N(CC(C)C)CC(C)C)cc1Cl |
| InChI | InChI=1S/C19H26ClN3O2/c1-13(2)10-23(11-14(3)4)12-15(9-21)19(24)22-16-6-7-18(25-5)17(20)8-16/h6-8,12-14H,10-11H2,1-5H3,(H,22,24)/b15-12- |
| InChIKey | BIGBKPGGMCTCRE-QINSGFPZSA-N |
| XLogP | 4.31 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|