C19H17ClN4O3 — CID 108825750
(Z)-3-(N-acetyl-4-aminoanilino)-N-(3-chloro-4-methoxyphenyl)-2-cyanoprop-2-enamide (PubChem CID 108825750) has the molecular formula C19H17ClN4O3 and a molecular weight of 384.82 g/mol. Its IUPAC name is (Z)-3-(N-acetyl-4-aminoanilino)-N-(3-chloro-4-methoxyphenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-(N-acetyl-4-aminoanilino)-N-(3-chloro-4-methoxyphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108825750 |
| Molecular Formula | C19H17ClN4O3 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (Z)-3-(N-acetyl-4-aminoanilino)-N-(3-chloro-4-methoxyphenyl)-2-cyanoprop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C\N(C(C)=O)c2ccc(N)cc2)cc1Cl |
| InChI | InChI=1S/C19H17ClN4O3/c1-12(25)24(16-6-3-14(22)4-7-16)11-13(10-21)19(26)23-15-5-8-18(27-2)17(20)9-15/h3-9,11H,22H2,1-2H3,(H,23,26)/b13-11- |
| InChIKey | KLOSMMAGBFOKMS-QBFSEMIESA-N |
| XLogP | 3.33 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|