C13H26N2O3 — CID 108911465
3-[(E)-3,3-dimethylbut-1-enyl]-1,1-bis(2-methoxyethyl)urea (PubChem CID 108911465) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-[(E)-3,3-dimethylbut-1-enyl]-1,1-bis(2-methoxyethyl)urea.
| Compound Name | 3-[(E)-3,3-dimethylbut-1-enyl]-1,1-bis(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 108911465 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 3-[(E)-3,3-dimethylbut-1-enyl]-1,1-bis(2-methoxyethyl)urea |
| SMILES | COCCN(CCOC)C(=O)N/C=C/C(C)(C)C |
| InChI | InChI=1S/C13H26N2O3/c1-13(2,3)6-7-14-12(16)15(8-10-17-4)9-11-18-5/h6-7H,8-11H2,1-5H3,(H,14,16)/b7-6+ |
| InChIKey | DMDIKVYGGOHLGO-VOTSOKGWSA-N |
| XLogP | 1.85 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |