C11H24N2 — CID 139931013
1-N,1-N'-di(propan-2-yl)pent-1-ene-1,1-diamine (PubChem CID 139931013) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 1-N,1-N'-di(propan-2-yl)pent-1-ene-1,1-diamine.
| Compound Name | 1-N,1-N'-di(propan-2-yl)pent-1-ene-1,1-diamine |
|---|---|
| PubChem CID | 139931013 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 1-N,1-N'-di(propan-2-yl)pent-1-ene-1,1-diamine |
| SMILES | CCCC=C(NC(C)C)NC(C)C |
| InChI | InChI=1S/C11H24N2/c1-6-7-8-11(12-9(2)3)13-10(4)5/h8-10,12-13H,6-7H2,1-5H3 |
| InChIKey | XDEUNDOMSFLAJZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |