About 2-methylpropane;(Z)-1-[(2-methylpropan-2-yl)oxy]-N-propan-2-ylpent-1-en-1-amine
2-methylpropane;(Z)-1-[(2-methylpropan-2-yl)oxy]-N-propan-2-ylpent-1-en-1-amine (PubChem CID 156646021) has the molecular formula C16H35NO
and a molecular weight of 257.46 g/mol. Its IUPAC name is 2-methylpropane;(Z)-1-[(2-methylpropan-2-yl)oxy]-N-propan-2-ylpent-1-en-1-amine.
Molecular Properties
| Compound Name | 2-methylpropane;(Z)-1-[(2-methylpropan-2-yl)oxy]-N-propan-2-ylpent-1-en-1-amine |
| PubChem CID | 156646021 |
| Molecular Formula | C16H35NO |
| Molecular Weight | 257.46 g/mol |
| Exact Mass | 257.27 |
| IUPAC Name | 2-methylpropane;(Z)-1-[(2-methylpropan-2-yl)oxy]-N-propan-2-ylpent-1-en-1-amine |
| SMILES | CC(C)C.CCC/C=C(/NC(C)C)OC(C)(C)C |
| InChI | InChI=1S/C12H25NO.C4H10/c1-7-8-9-11(13-10(2)3)14-12(4,5)6;1-4(2)3/h9-10,13H,7-8H2,1-6H3;4H,1-3H3/b11-9-; |
| InChIKey | CZJFQMVMQZIGMO-KSIDEHCFSA-N |
| XLogP | 5.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 257.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropane;(Z)-1-[(2-methylpropan-2-yl)oxy]-N-propan-2-ylpent-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;(Z)-1-[(2-methylpropan-2-yl)oxy]-N-propan-2-ylpent-1-en-1-amine?
The IUPAC name of 2-methylpropane;(Z)-1-[(2-methylpropan-2-yl)oxy]-N-propan-2-ylpent-1-en-1-amine (CID 156646021) is 2-methylpropane;(Z)-1-[(2-methylpropan-2-yl)oxy]-N-propan-2-ylpent-1-en-1-amine.
What is the SMILES notation for 2-methylpropane;(Z)-1-[(2-methylpropan-2-yl)oxy]-N-propan-2-ylpent-1-en-1-amine?
The canonical SMILES for 2-methylpropane;(Z)-1-[(2-methylpropan-2-yl)oxy]-N-propan-2-ylpent-1-en-1-amine is CC(C)C.CCC/C=C(/NC(C)C)OC(C)(C)C.
What is the InChIKey of 2-methylpropane;(Z)-1-[(2-methylpropan-2-yl)oxy]-N-propan-2-ylpent-1-en-1-amine?
The InChIKey is CZJFQMVMQZIGMO-KSIDEHCFSA-N. The full InChI is InChI=1S/C12H25NO.C4H10/c1-7-8-9-11(13-10(2)3)14-12(4,5)6;1-4(2)3/h9-10,13H,7-8H2,1-6H3;4H,1-3H3/b11-9-;.
What are the key properties of 2-methylpropane;(Z)-1-[(2-methylpropan-2-yl)oxy]-N-propan-2-ylpent-1-en-1-amine?
2-methylpropane;(Z)-1-[(2-methylpropan-2-yl)oxy]-N-propan-2-ylpent-1-en-1-amine has a molecular weight of 257.46 g/mol, XLogP of 5.10, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;(Z)-1-[(2-methylpropan-2-yl)oxy]-N-propan-2-ylpent-1-en-1-amine is sourced from PubChem (CID 156646021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).