C21H33NO2 — CID 155725884
2-methylpropane;(2E)-2-[(2-methyl-5,6,7,8-tetrahydroquinolin-3-yl)methylidene]hexanoic acid (PubChem CID 155725884) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is 2-methylpropane;(2E)-2-[(2-methyl-5,6,7,8-tetrahydroquinolin-3-yl)methylidene]hexanoic acid.
| Compound Name | 2-methylpropane;(2E)-2-[(2-methyl-5,6,7,8-tetrahydroquinolin-3-yl)methylidene]hexanoic acid |
|---|---|
| PubChem CID | 155725884 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | 2-methylpropane;(2E)-2-[(2-methyl-5,6,7,8-tetrahydroquinolin-3-yl)methylidene]hexanoic acid |
| SMILES | CC(C)C.CCCC/C(=C\c1cc2c(nc1C)CCCC2)C(=O)O |
| InChI | InChI=1S/C17H23NO2.C4H10/c1-3-4-7-14(17(19)20)11-15-10-13-8-5-6-9-16(13)18-12(15)2;1-4(2)3/h10-11H,3-9H2,1-2H3,(H,19,20);4H,1-3H3/b14-11+; |
| InChIKey | DXYSPSXCAUOCSL-JHGYPSGKSA-N |
| XLogP | 5.59 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|