C13H17NO2 — CID 163905685
2-(1-methoxyethyl)-5,6,7,8-tetrahydroquinoline-3-carbaldehyde (PubChem CID 163905685) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-(1-methoxyethyl)-5,6,7,8-tetrahydroquinoline-3-carbaldehyde.
| Compound Name | 2-(1-methoxyethyl)-5,6,7,8-tetrahydroquinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 163905685 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-(1-methoxyethyl)-5,6,7,8-tetrahydroquinoline-3-carbaldehyde |
| SMILES | COC(C)c1nc2c(cc1C=O)CCCC2 |
| InChI | InChI=1S/C13H17NO2/c1-9(16-2)13-11(8-15)7-10-5-3-4-6-12(10)14-13/h7-9H,3-6H2,1-2H3 |
| InChIKey | IIIGUALXUKYRPJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|