C13H19N — CID 20824284
2-methyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline (PubChem CID 20824284) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 2-methyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline.
| Compound Name | 2-methyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 20824284 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2-methyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline |
| SMILES | Cc1nc2c(cc1C(C)C)CCCC2 |
| InChI | InChI=1S/C13H19N/c1-9(2)12-8-11-6-4-5-7-13(11)14-10(12)3/h8-9H,4-7H2,1-3H3 |
| InChIKey | FLONVGZUDUPHBG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |