C11H13NO2 — CID 54471711
4-deuterio-2-methoxy-5,6,7,8-tetrahydroquinoline-3-carbaldehyde (PubChem CID 54471711) has the molecular formula C11H13NO2 and a molecular weight of 192.24 g/mol. Its IUPAC name is 4-deuterio-2-methoxy-5,6,7,8-tetrahydroquinoline-3-carbaldehyde.
| Compound Name | 4-deuterio-2-methoxy-5,6,7,8-tetrahydroquinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 54471711 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 4-deuterio-2-methoxy-5,6,7,8-tetrahydroquinoline-3-carbaldehyde |
| SMILES | [2H]c1c(C=O)c(OC)nc2c1CCCC2 |
| InChI | InChI=1S/C11H13NO2/c1-14-11-9(7-13)6-8-4-2-3-5-10(8)12-11/h6-7H,2-5H2,1H3/i6D |
| InChIKey | XIUSGWDZCGZUMD-RAMDWTOOSA-N |
| XLogP | 1.78 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|