C10H12BrNO — CID 154352348
3-bromo-1-methoxy-5,6,7,8-tetrahydroisoquinoline (PubChem CID 154352348) has the molecular formula C10H12BrNO and a molecular weight of 242.12 g/mol. Its IUPAC name is 3-bromo-1-methoxy-5,6,7,8-tetrahydroisoquinoline.
| Compound Name | 3-bromo-1-methoxy-5,6,7,8-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 154352348 |
| Molecular Formula | C10H12BrNO |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 3-bromo-1-methoxy-5,6,7,8-tetrahydroisoquinoline |
| SMILES | COc1nc(Br)cc2c1CCCC2 |
| InChI | InChI=1S/C10H12BrNO/c1-13-10-8-5-3-2-4-7(8)6-9(11)12-10/h6H,2-5H2,1H3 |
| InChIKey | IWZXWXGHLHIYCD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|