C11H10BrNO — CID 117383062
7-bromo-6-methoxy-2,3-dihydro-1H-indene-5-carbonitrile (PubChem CID 117383062) has the molecular formula C11H10BrNO and a molecular weight of 252.11 g/mol. Its IUPAC name is 7-bromo-6-methoxy-2,3-dihydro-1H-indene-5-carbonitrile.
| Compound Name | 7-bromo-6-methoxy-2,3-dihydro-1H-indene-5-carbonitrile |
|---|---|
| PubChem CID | 117383062 |
| Molecular Formula | C11H10BrNO |
| Molecular Weight | 252.11 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | 7-bromo-6-methoxy-2,3-dihydro-1H-indene-5-carbonitrile |
| SMILES | COc1c(C#N)cc2c(c1Br)CCC2 |
| InChI | InChI=1S/C11H10BrNO/c1-14-11-8(6-13)5-7-3-2-4-9(7)10(11)12/h5H,2-4H2,1H3 |
| InChIKey | NCKFJSZOAWOHBK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.11 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |