C13H17NO3 — CID 159500959
5,5-dideuterio-2-(dimethoxymethyl)-7,8-dihydro-6H-quinoline-3-carbaldehyde (PubChem CID 159500959) has the molecular formula C13H17NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 5,5-dideuterio-2-(dimethoxymethyl)-7,8-dihydro-6H-quinoline-3-carbaldehyde.
| Compound Name | 5,5-dideuterio-2-(dimethoxymethyl)-7,8-dihydro-6H-quinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 159500959 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 5,5-dideuterio-2-(dimethoxymethyl)-7,8-dihydro-6H-quinoline-3-carbaldehyde |
| SMILES | [2H]C1([2H])CCCc2nc(C(OC)OC)c(C=O)cc21 |
| InChI | InChI=1S/C13H17NO3/c1-16-13(17-2)12-10(8-15)7-9-5-3-4-6-11(9)14-12/h7-8,13H,3-6H2,1-2H3/i5D2 |
| InChIKey | LZJNIOCVKDYUAQ-BFWBPSQCSA-N |
| XLogP | 2.06 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|