C11H16F3N — CID 134365692
(2Z,7E)-9,9,9-trifluoro-N,8-dimethylnona-2,5,7-trien-4-amine (PubChem CID 134365692) has the molecular formula C11H16F3N and a molecular weight of 219.25 g/mol. Its IUPAC name is (2Z,7E)-9,9,9-trifluoro-N,8-dimethylnona-2,5,7-trien-4-amine.
| Compound Name | (2Z,7E)-9,9,9-trifluoro-N,8-dimethylnona-2,5,7-trien-4-amine |
|---|---|
| PubChem CID | 134365692 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | (2Z,7E)-9,9,9-trifluoro-N,8-dimethylnona-2,5,7-trien-4-amine |
| SMILES | C/C=C\C(C=C/C=C(\C)C(F)(F)F)NC |
| InChI | InChI=1S/C11H16F3N/c1-4-6-10(15-3)8-5-7-9(2)11(12,13)14/h4-8,10,15H,1-3H3/b6-4-,8-5?,9-7+ |
| InChIKey | LNYMRVLOQGRYJA-MERJQDHLSA-N |
| XLogP | 3.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|