C14H17ClN2 — CID 123295745
(Z)-2-cyano-N-[(3E)-3-prop-1-enylhexa-1,3-dien-2-yl]but-2-enimidoyl chloride (PubChem CID 123295745) has the molecular formula C14H17ClN2 and a molecular weight of 248.76 g/mol. Its IUPAC name is (Z)-2-cyano-N-[(3E)-3-prop-1-enylhexa-1,3-dien-2-yl]but-2-enimidoyl chloride.
| Compound Name | (Z)-2-cyano-N-[(3E)-3-prop-1-enylhexa-1,3-dien-2-yl]but-2-enimidoyl chloride |
|---|---|
| PubChem CID | 123295745 |
| Molecular Formula | C14H17ClN2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | (Z)-2-cyano-N-[(3E)-3-prop-1-enylhexa-1,3-dien-2-yl]but-2-enimidoyl chloride |
| SMILES | C=C(/N=C(Cl)/C(C#N)=C\C)/C(C=CC)=C/CC |
| InChI | InChI=1S/C14H17ClN2/c1-5-8-13(9-6-2)11(4)17-14(15)12(7-3)10-16/h5,7-9H,4,6H2,1-3H3/b8-5?,12-7-,13-9+,17-14- |
| InChIKey | YQAHLRYRLWQUPJ-XOMCRFKHSA-N |
| XLogP | 4.52 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|