C11H18N2 — CID 166877084
(1E)-3-N-(2-methylprop-1-enyl)-2-[(Z)-prop-1-enyl]buta-1,3-diene-1,3-diamine (PubChem CID 166877084) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (1E)-3-N-(2-methylprop-1-enyl)-2-[(Z)-prop-1-enyl]buta-1,3-diene-1,3-diamine.
| Compound Name | (1E)-3-N-(2-methylprop-1-enyl)-2-[(Z)-prop-1-enyl]buta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 166877084 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (1E)-3-N-(2-methylprop-1-enyl)-2-[(Z)-prop-1-enyl]buta-1,3-diene-1,3-diamine |
| SMILES | C=C(NC=C(C)C)C(/C=C\C)=C/N |
| InChI | InChI=1S/C11H18N2/c1-5-6-11(7-12)10(4)13-8-9(2)3/h5-8,13H,4,12H2,1-3H3/b6-5-,11-7+ |
| InChIKey | IUCIAZJXCBBWJQ-GNLLZQBYSA-N |
| XLogP | 2.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|