C9H14N2O — CID 142233106
N-[(E)-[(4Z)-4-ethenoxyhexa-1,4-dien-3-ylidene]amino]methanamine (PubChem CID 142233106) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is N-[(E)-[(4Z)-4-ethenoxyhexa-1,4-dien-3-ylidene]amino]methanamine.
| Compound Name | N-[(E)-[(4Z)-4-ethenoxyhexa-1,4-dien-3-ylidene]amino]methanamine |
|---|---|
| PubChem CID | 142233106 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | N-[(E)-[(4Z)-4-ethenoxyhexa-1,4-dien-3-ylidene]amino]methanamine |
| SMILES | C=COC(=C\C)/C(C=C)=N/NC |
| InChI | InChI=1S/C9H14N2O/c1-5-8(11-10-4)9(6-2)12-7-3/h5-7,10H,1,3H2,2,4H3/b9-6-,11-8+ |
| InChIKey | ALRYKYAIESKLKP-DJAXYUIYSA-N |
| XLogP | 1.81 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|