About 1-methoxyethenethiolate
1-methoxyethenethiolate (PubChem CID 134871761) has the molecular formula C3H5OS-
and a molecular weight of 89.14 g/mol. Its IUPAC name is 1-methoxyethenethiolate.
Molecular Properties
| Compound Name | 1-methoxyethenethiolate |
| PubChem CID | 134871761 |
| Molecular Formula | C3H5OS- |
| Molecular Weight | 89.14 g/mol |
| Exact Mass | 89.01 |
| IUPAC Name | 1-methoxyethenethiolate |
| SMILES | C=C([S-])OC |
| InChI | InChI=1S/C3H6OS/c1-3(5)4-2/h5H,1H2,2H3/p-1 |
| InChIKey | UFNKOKAVXWUVLQ-UHFFFAOYSA-M |
| XLogP | 0.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.14 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxyethenethiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyethenethiolate?
The IUPAC name of 1-methoxyethenethiolate (CID 134871761) is 1-methoxyethenethiolate.
What is the SMILES notation for 1-methoxyethenethiolate?
The canonical SMILES for 1-methoxyethenethiolate is C=C([S-])OC.
What is the InChIKey of 1-methoxyethenethiolate?
The InChIKey is UFNKOKAVXWUVLQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6OS/c1-3(5)4-2/h5H,1H2,2H3/p-1.
What are the key properties of 1-methoxyethenethiolate?
1-methoxyethenethiolate has a molecular weight of 89.14 g/mol, XLogP of 0.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyethenethiolate is sourced from PubChem (CID 134871761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).