About dimethoxy(methyl)borane;ethane;2-methylprop-1-ene
dimethoxy(methyl)borane;ethane;2-methylprop-1-ene (PubChem CID 157498459) has the molecular formula C11H29BO2
and a molecular weight of 204.16 g/mol. Its IUPAC name is dimethoxy(methyl)borane;ethane;2-methylprop-1-ene.
Molecular Properties
| Compound Name | dimethoxy(methyl)borane;ethane;2-methylprop-1-ene |
| PubChem CID | 157498459 |
| Molecular Formula | C11H29BO2 |
| Molecular Weight | 204.16 g/mol |
| Exact Mass | 204.23 |
| IUPAC Name | dimethoxy(methyl)borane;ethane;2-methylprop-1-ene |
| SMILES | C=C(C)C.CC.CC.COB(C)OC |
| InChI | InChI=1S/C4H8.C3H9BO2.2C2H6/c1-4(2)3;1-4(5-2)6-3;2*1-2/h1H2,2-3H3;1-3H3;2*1-2H3 |
| InChIKey | BYCRBONEYSIWJX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.16 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy(methyl)borane;ethane;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy(methyl)borane;ethane;2-methylprop-1-ene?
The IUPAC name of dimethoxy(methyl)borane;ethane;2-methylprop-1-ene (CID 157498459) is dimethoxy(methyl)borane;ethane;2-methylprop-1-ene.
What is the SMILES notation for dimethoxy(methyl)borane;ethane;2-methylprop-1-ene?
The canonical SMILES for dimethoxy(methyl)borane;ethane;2-methylprop-1-ene is C=C(C)C.CC.CC.COB(C)OC.
What is the InChIKey of dimethoxy(methyl)borane;ethane;2-methylprop-1-ene?
The InChIKey is BYCRBONEYSIWJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8.C3H9BO2.2C2H6/c1-4(2)3;1-4(5-2)6-3;2*1-2/h1H2,2-3H3;1-3H3;2*1-2H3.
What are the key properties of dimethoxy(methyl)borane;ethane;2-methylprop-1-ene?
dimethoxy(methyl)borane;ethane;2-methylprop-1-ene has a molecular weight of 204.16 g/mol, XLogP of 4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy(methyl)borane;ethane;2-methylprop-1-ene is sourced from PubChem (CID 157498459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).