About 1-methoxyethenolate;tris(propan-2-olate);titanium(4+)
1-methoxyethenolate;tris(propan-2-olate);titanium(4+) (PubChem CID 100955524) has the molecular formula C12H26O5Ti
and a molecular weight of 298.20 g/mol. Its IUPAC name is 1-methoxyethenolate;tris(propan-2-olate);titanium(4+).
Molecular Properties
| Compound Name | 1-methoxyethenolate;tris(propan-2-olate);titanium(4+) |
| PubChem CID | 100955524 |
| Molecular Formula | C12H26O5Ti |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 1-methoxyethenolate;tris(propan-2-olate);titanium(4+) |
| SMILES | C=C([O-])OC.CC(C)[O-].CC(C)[O-].CC(C)[O-].[Ti+4] |
| InChI | InChI=1S/C3H6O2.3C3H7O.Ti/c1-3(4)5-2;3*1-3(2)4;/h4H,1H2,2H3;3*3H,1-2H3;/q;3*-1;+4/p-1 |
| InChIKey | XFTSXNWPVNORJV-UHFFFAOYSA-M |
| XLogP | -1.27 |
| TPSA | 101.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxyethenolate;tris(propan-2-olate);titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyethenolate;tris(propan-2-olate);titanium(4+)?
The IUPAC name of 1-methoxyethenolate;tris(propan-2-olate);titanium(4+) (CID 100955524) is 1-methoxyethenolate;tris(propan-2-olate);titanium(4+).
What is the SMILES notation for 1-methoxyethenolate;tris(propan-2-olate);titanium(4+)?
The canonical SMILES for 1-methoxyethenolate;tris(propan-2-olate);titanium(4+) is C=C([O-])OC.CC(C)[O-].CC(C)[O-].CC(C)[O-].[Ti+4].
What is the InChIKey of 1-methoxyethenolate;tris(propan-2-olate);titanium(4+)?
The InChIKey is XFTSXNWPVNORJV-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O2.3C3H7O.Ti/c1-3(4)5-2;3*1-3(2)4;/h4H,1H2,2H3;3*3H,1-2H3;/q;3*-1;+4/p-1.
What are the key properties of 1-methoxyethenolate;tris(propan-2-olate);titanium(4+)?
1-methoxyethenolate;tris(propan-2-olate);titanium(4+) has a molecular weight of 298.20 g/mol, XLogP of -1.27, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyethenolate;tris(propan-2-olate);titanium(4+) is sourced from PubChem (CID 100955524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).