C7H13N3O2 — CID 175440169
N'-(2-aminopropanoyl)-2-methylprop-2-enehydrazide (PubChem CID 175440169) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is N'-(2-aminopropanoyl)-2-methylprop-2-enehydrazide.
| Compound Name | N'-(2-aminopropanoyl)-2-methylprop-2-enehydrazide |
|---|---|
| PubChem CID | 175440169 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | N'-(2-aminopropanoyl)-2-methylprop-2-enehydrazide |
| SMILES | C=C(C)C(=O)NNC(=O)C(C)N |
| InChI | InChI=1S/C7H13N3O2/c1-4(2)6(11)9-10-7(12)5(3)8/h5H,1,8H2,2-3H3,(H,9,11)(H,10,12) |
| InChIKey | NFMTVPRYUHJYTL-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|