C7H12N2O3 — CID 88922229
2-[2-(2-methylprop-2-enoyl)hydrazinyl]propanoic acid (PubChem CID 88922229) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is 2-[2-(2-methylprop-2-enoyl)hydrazinyl]propanoic acid.
| Compound Name | 2-[2-(2-methylprop-2-enoyl)hydrazinyl]propanoic acid |
|---|---|
| PubChem CID | 88922229 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 2-[2-(2-methylprop-2-enoyl)hydrazinyl]propanoic acid |
| SMILES | C=C(C)C(=O)NNC(C)C(=O)O |
| InChI | InChI=1S/C7H12N2O3/c1-4(2)6(10)9-8-5(3)7(11)12/h5,8H,1H2,2-3H3,(H,9,10)(H,11,12) |
| InChIKey | IBOZUIXJQIJTSE-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|