C11H20ClNO2 — CID 173326551
N-(3-ethyl-1-oxopentan-3-yl)-2-methylprop-2-enamide;hydrochloride (PubChem CID 173326551) has the molecular formula C11H20ClNO2 and a molecular weight of 233.74 g/mol. Its IUPAC name is N-(3-ethyl-1-oxopentan-3-yl)-2-methylprop-2-enamide;hydrochloride.
| Compound Name | N-(3-ethyl-1-oxopentan-3-yl)-2-methylprop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 173326551 |
| Molecular Formula | C11H20ClNO2 |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-(3-ethyl-1-oxopentan-3-yl)-2-methylprop-2-enamide;hydrochloride |
| SMILES | C=C(C)C(=O)NC(CC)(CC)CC=O.Cl |
| InChI | InChI=1S/C11H19NO2.ClH/c1-5-11(6-2,7-8-13)12-10(14)9(3)4;/h8H,3,5-7H2,1-2,4H3,(H,12,14);1H |
| InChIKey | YMVMMFSWTWTMIX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|