C17H25NO5 — CID 154599042
[2-(2-methylprop-2-enoylamino)-2-(2-methylprop-2-enoyloxymethyl)butyl] 2-methylprop-2-enoate (PubChem CID 154599042) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is [2-(2-methylprop-2-enoylamino)-2-(2-methylprop-2-enoyloxymethyl)butyl] 2-methylprop-2-enoate.
| Compound Name | [2-(2-methylprop-2-enoylamino)-2-(2-methylprop-2-enoyloxymethyl)butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154599042 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | [2-(2-methylprop-2-enoylamino)-2-(2-methylprop-2-enoyloxymethyl)butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)NC(CC)(COC(=O)C(=C)C)COC(=O)C(=C)C |
| InChI | InChI=1S/C17H25NO5/c1-8-17(18-14(19)11(2)3,9-22-15(20)12(4)5)10-23-16(21)13(6)7/h2,4,6,8-10H2,1,3,5,7H3,(H,18,19) |
| InChIKey | RYUARKLJDWGPAF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|