About ethyl 2-(tert-butylamino)-2-oxoacetate;ethyl 2-methylprop-2-enoate
ethyl 2-(tert-butylamino)-2-oxoacetate;ethyl 2-methylprop-2-enoate (PubChem CID 19391810) has the molecular formula C14H25NO5
and a molecular weight of 287.36 g/mol. Its IUPAC name is ethyl 2-(tert-butylamino)-2-oxoacetate;ethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | ethyl 2-(tert-butylamino)-2-oxoacetate;ethyl 2-methylprop-2-enoate |
| PubChem CID | 19391810 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | ethyl 2-(tert-butylamino)-2-oxoacetate;ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC.CCOC(=O)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C8H15NO3.C6H10O2/c1-5-12-7(11)6(10)9-8(2,3)4;1-4-8-6(7)5(2)3/h5H2,1-4H3,(H,9,10);2,4H2,1,3H3 |
| InChIKey | PFUMENONSULIJU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(tert-butylamino)-2-oxoacetate;ethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(tert-butylamino)-2-oxoacetate;ethyl 2-methylprop-2-enoate?
The IUPAC name of ethyl 2-(tert-butylamino)-2-oxoacetate;ethyl 2-methylprop-2-enoate (CID 19391810) is ethyl 2-(tert-butylamino)-2-oxoacetate;ethyl 2-methylprop-2-enoate.
What is the SMILES notation for ethyl 2-(tert-butylamino)-2-oxoacetate;ethyl 2-methylprop-2-enoate?
The canonical SMILES for ethyl 2-(tert-butylamino)-2-oxoacetate;ethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCC.CCOC(=O)C(=O)NC(C)(C)C.
What is the InChIKey of ethyl 2-(tert-butylamino)-2-oxoacetate;ethyl 2-methylprop-2-enoate?
The InChIKey is PFUMENONSULIJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3.C6H10O2/c1-5-12-7(11)6(10)9-8(2,3)4;1-4-8-6(7)5(2)3/h5H2,1-4H3,(H,9,10);2,4H2,1,3H3.
What are the key properties of ethyl 2-(tert-butylamino)-2-oxoacetate;ethyl 2-methylprop-2-enoate?
ethyl 2-(tert-butylamino)-2-oxoacetate;ethyl 2-methylprop-2-enoate has a molecular weight of 287.36 g/mol, XLogP of 1.59, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(tert-butylamino)-2-oxoacetate;ethyl 2-methylprop-2-enoate is sourced from PubChem (CID 19391810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).