C10H20NO4P — CID 87115726
3-[(2-methylprop-2-enoylamino)methyl]pentan-3-ylphosphonic acid (PubChem CID 87115726) has the molecular formula C10H20NO4P and a molecular weight of 249.25 g/mol. Its IUPAC name is 3-[(2-methylprop-2-enoylamino)methyl]pentan-3-ylphosphonic acid.
| Compound Name | 3-[(2-methylprop-2-enoylamino)methyl]pentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 87115726 |
| Molecular Formula | C10H20NO4P |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 3-[(2-methylprop-2-enoylamino)methyl]pentan-3-ylphosphonic acid |
| SMILES | C=C(C)C(=O)NCC(CC)(CC)P(=O)(O)O |
| InChI | InChI=1S/C10H20NO4P/c1-5-10(6-2,16(13,14)15)7-11-9(12)8(3)4/h3,5-7H2,1-2,4H3,(H,11,12)(H2,13,14,15) |
| InChIKey | OOKVFYVQXAADTO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|