C12H22N2O3 — CID 159640819
N-(2-amino-2-methylpropyl)-2-methylprop-2-enamide;2-methylprop-2-enoic acid (PubChem CID 159640819) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-2-methylprop-2-enamide;2-methylprop-2-enoic acid.
| Compound Name | N-(2-amino-2-methylpropyl)-2-methylprop-2-enamide;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 159640819 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-2-methylprop-2-enamide;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)NCC(C)(C)N.C=C(C)C(=O)O |
| InChI | InChI=1S/C8H16N2O.C4H6O2/c1-6(2)7(11)10-5-8(3,4)9;1-3(2)4(5)6/h1,5,9H2,2-4H3,(H,10,11);1H2,2H3,(H,5,6) |
| InChIKey | MQIIZFQSPJDQNZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|