C8H19N2O5P — CID 88539843
N-(4-aminobutyl)-2-methylprop-2-enamide;phosphoric acid (PubChem CID 88539843) has the molecular formula C8H19N2O5P and a molecular weight of 254.22 g/mol. Its IUPAC name is N-(4-aminobutyl)-2-methylprop-2-enamide;phosphoric acid.
| Compound Name | N-(4-aminobutyl)-2-methylprop-2-enamide;phosphoric acid |
|---|---|
| PubChem CID | 88539843 |
| Molecular Formula | C8H19N2O5P |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | N-(4-aminobutyl)-2-methylprop-2-enamide;phosphoric acid |
| SMILES | C=C(C)C(=O)NCCCCN.O=P(O)(O)O |
| InChI | InChI=1S/C8H16N2O.H3O4P/c1-7(2)8(11)10-6-4-3-5-9;1-5(2,3)4/h1,3-6,9H2,2H3,(H,10,11);(H3,1,2,3,4) |
| InChIKey | YQFSUHWIMPUAFY-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|