C14H29N2O3PS — CID 20684941
N-[10-(dihydroxyphosphinothioylamino)decyl]-2-methylprop-2-enamide (PubChem CID 20684941) has the molecular formula C14H29N2O3PS and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[10-(dihydroxyphosphinothioylamino)decyl]-2-methylprop-2-enamide.
| Compound Name | N-[10-(dihydroxyphosphinothioylamino)decyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 20684941 |
| Molecular Formula | C14H29N2O3PS |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-[10-(dihydroxyphosphinothioylamino)decyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCCCCCCCCNP(O)(O)=S |
| InChI | InChI=1S/C14H29N2O3PS/c1-13(2)14(17)15-11-9-7-5-3-4-6-8-10-12-16-20(18,19)21/h1,3-12H2,2H3,(H,15,17)(H3,16,18,19,21) |
| InChIKey | LGLTZQUNRFFXDZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|