C14H28NO4P — CID 18935053
10-(2-methylprop-2-enoylamino)decylphosphonic acid (PubChem CID 18935053) has the molecular formula C14H28NO4P and a molecular weight of 305.35 g/mol. Its IUPAC name is 10-(2-methylprop-2-enoylamino)decylphosphonic acid.
| Compound Name | 10-(2-methylprop-2-enoylamino)decylphosphonic acid |
|---|---|
| PubChem CID | 18935053 |
| Molecular Formula | C14H28NO4P |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 10-(2-methylprop-2-enoylamino)decylphosphonic acid |
| SMILES | C=C(C)C(=O)NCCCCCCCCCCP(=O)(O)O |
| InChI | InChI=1S/C14H28NO4P/c1-13(2)14(16)15-11-9-7-5-3-4-6-8-10-12-20(17,18)19/h1,3-12H2,2H3,(H,15,16)(H2,17,18,19) |
| InChIKey | VZTLGXUGPOHFTG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|