C12H26N2O5P+ — CID 137354355
[hydroxy-[5-(2-methylprop-2-enoylamino)pentoxy]phosphoryl]oxy-trimethylazanium (PubChem CID 137354355) has the molecular formula C12H26N2O5P+ and a molecular weight of 309.32 g/mol. Its IUPAC name is [hydroxy-[5-(2-methylprop-2-enoylamino)pentoxy]phosphoryl]oxy-trimethylazanium.
| Compound Name | [hydroxy-[5-(2-methylprop-2-enoylamino)pentoxy]phosphoryl]oxy-trimethylazanium |
|---|---|
| PubChem CID | 137354355 |
| Molecular Formula | C12H26N2O5P+ |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | [hydroxy-[5-(2-methylprop-2-enoylamino)pentoxy]phosphoryl]oxy-trimethylazanium |
| SMILES | C=C(C)C(=O)NCCCCCOP(=O)(O)O[N+](C)(C)C |
| InChI | InChI=1S/C12H25N2O5P/c1-11(2)12(15)13-9-7-6-8-10-18-20(16,17)19-14(3,4)5/h1,6-10H2,2-5H3,(H-,13,15,16,17)/p+1 |
| InChIKey | LPNLYPPGCQCJKK-UHFFFAOYSA-O |
| XLogP | 1.60 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|