C26H47N7O5 — CID 88854923
6-amino-2-[[6-amino-2-(2-methylprop-2-enoylamino)hexanoyl]amino]-N-[1-amino-6-(2-methylprop-2-enoylamino)-1-oxohexan-2-yl]hexanamide (PubChem CID 88854923) has the molecular formula C26H47N7O5 and a molecular weight of 537.71 g/mol. Its IUPAC name is 6-amino-2-[[6-amino-2-(2-methylprop-2-enoylamino)hexanoyl]amino]-N-[1-amino-6-(2-methylprop-2-enoylamino)-1-oxohexan-2-yl]hexanamide.
| Compound Name | 6-amino-2-[[6-amino-2-(2-methylprop-2-enoylamino)hexanoyl]amino]-N-[1-amino-6-(2-methylprop-2-enoylamino)-1-oxohexan-2-yl]hexanamide |
|---|---|
| PubChem CID | 88854923 |
| Molecular Formula | C26H47N7O5 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.36 |
| IUPAC Name | 6-amino-2-[[6-amino-2-(2-methylprop-2-enoylamino)hexanoyl]amino]-N-[1-amino-6-(2-methylprop-2-enoylamino)-1-oxohexan-2-yl]hexanamide |
| SMILES | C=C(C)C(=O)NCCCCC(NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(=C)C)C(N)=O |
| InChI | InChI=1S/C26H47N7O5/c1-17(2)23(35)30-16-10-7-11-19(22(29)34)31-25(37)21(13-6-9-15-28)33-26(38)20(12-5-8-14-27)32-24(36)18(3)4/h19-21H,1,3,5-16,27-28H2,2,4H3,(H2,29,34)(H,30,35)(H,31,37)(H,32,36)(H,33,38) |
| InChIKey | YVIDCWIUFLVSLZ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 211.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|