C18H36N2O2 — CID 161329550
N'-tert-butyl-N-propan-2-ylundecanediamide (PubChem CID 161329550) has the molecular formula C18H36N2O2 and a molecular weight of 312.50 g/mol. Its IUPAC name is N'-tert-butyl-N-propan-2-ylundecanediamide.
| Compound Name | N'-tert-butyl-N-propan-2-ylundecanediamide |
|---|---|
| PubChem CID | 161329550 |
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | N'-tert-butyl-N-propan-2-ylundecanediamide |
| SMILES | CC(C)NC(=O)CCCCCCCCCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H36N2O2/c1-15(2)19-16(21)13-11-9-7-6-8-10-12-14-17(22)20-18(3,4)5/h15H,6-14H2,1-5H3,(H,19,21)(H,20,22) |
| InChIKey | QYNMTYIKXAVIBA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|