C24H49NO — CID 144715726
N-tert-butyl-7,11-dipropyltetradecanamide (PubChem CID 144715726) has the molecular formula C24H49NO and a molecular weight of 367.66 g/mol. Its IUPAC name is N-tert-butyl-7,11-dipropyltetradecanamide.
| Compound Name | N-tert-butyl-7,11-dipropyltetradecanamide |
|---|---|
| PubChem CID | 144715726 |
| Molecular Formula | C24H49NO |
| Molecular Weight | 367.66 g/mol |
| Exact Mass | 367.38 |
| IUPAC Name | N-tert-butyl-7,11-dipropyltetradecanamide |
| SMILES | CCCC(CCC)CCCC(CCC)CCCCCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C24H49NO/c1-7-14-21(15-8-2)18-13-19-22(16-9-3)17-11-10-12-20-23(26)25-24(4,5)6/h21-22H,7-20H2,1-6H3,(H,25,26) |
| InChIKey | YGYVIEWFJVRUKC-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.66 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|