C22H45NO2 — CID 123167057
N-(2-hydroxyethyl)-10,14-dimethyl-6-propylpentadecanamide (PubChem CID 123167057) has the molecular formula C22H45NO2 and a molecular weight of 355.61 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-10,14-dimethyl-6-propylpentadecanamide.
| Compound Name | N-(2-hydroxyethyl)-10,14-dimethyl-6-propylpentadecanamide |
|---|---|
| PubChem CID | 123167057 |
| Molecular Formula | C22H45NO2 |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 355.35 |
| IUPAC Name | N-(2-hydroxyethyl)-10,14-dimethyl-6-propylpentadecanamide |
| SMILES | CCCC(CCCCC(=O)NCCO)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C22H45NO2/c1-5-10-21(14-6-7-16-22(25)23-17-18-24)15-9-13-20(4)12-8-11-19(2)3/h19-21,24H,5-18H2,1-4H3,(H,23,25) |
| InChIKey | DGFXIUQTHSXLQG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|