About 14-methyl-4,10-dipropylheptadecan-1-ol
14-methyl-4,10-dipropylheptadecan-1-ol (PubChem CID 118203440) has the molecular formula C24H50O
and a molecular weight of 354.66 g/mol. Its IUPAC name is 14-methyl-4,10-dipropylheptadecan-1-ol.
Molecular Properties
| Compound Name | 14-methyl-4,10-dipropylheptadecan-1-ol |
| PubChem CID | 118203440 |
| Molecular Formula | C24H50O |
| Molecular Weight | 354.66 g/mol |
| Exact Mass | 354.39 |
| IUPAC Name | 14-methyl-4,10-dipropylheptadecan-1-ol |
| SMILES | CCCC(C)CCCC(CCC)CCCCCC(CCC)CCCO |
| InChI | InChI=1S/C24H50O/c1-5-13-22(4)16-11-19-23(14-6-2)17-9-8-10-18-24(15-7-3)20-12-21-25/h22-25H,5-21H2,1-4H3 |
| InChIKey | XIIITMALZVTPGO-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.66 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 14-methyl-4,10-dipropylheptadecan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14-methyl-4,10-dipropylheptadecan-1-ol?
The IUPAC name of 14-methyl-4,10-dipropylheptadecan-1-ol (CID 118203440) is 14-methyl-4,10-dipropylheptadecan-1-ol.
What is the SMILES notation for 14-methyl-4,10-dipropylheptadecan-1-ol?
The canonical SMILES for 14-methyl-4,10-dipropylheptadecan-1-ol is CCCC(C)CCCC(CCC)CCCCCC(CCC)CCCO.
What is the InChIKey of 14-methyl-4,10-dipropylheptadecan-1-ol?
The InChIKey is XIIITMALZVTPGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H50O/c1-5-13-22(4)16-11-19-23(14-6-2)17-9-8-10-18-24(15-7-3)20-12-21-25/h22-25H,5-21H2,1-4H3.
What are the key properties of 14-methyl-4,10-dipropylheptadecan-1-ol?
14-methyl-4,10-dipropylheptadecan-1-ol has a molecular weight of 354.66 g/mol, XLogP of 8.15, 19 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 14-methyl-4,10-dipropylheptadecan-1-ol is sourced from PubChem (CID 118203440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).