About 6-methylnonane-1,1-diol;6-methylnonan-1-ol
6-methylnonane-1,1-diol;6-methylnonan-1-ol (PubChem CID 90947369) has the molecular formula C20H44O3
and a molecular weight of 332.57 g/mol. Its IUPAC name is 6-methylnonane-1,1-diol;6-methylnonan-1-ol.
Molecular Properties
| Compound Name | 6-methylnonane-1,1-diol;6-methylnonan-1-ol |
| PubChem CID | 90947369 |
| Molecular Formula | C20H44O3 |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.33 |
| IUPAC Name | 6-methylnonane-1,1-diol;6-methylnonan-1-ol |
| SMILES | CCCC(C)CCCCC(O)O.CCCC(C)CCCCCO |
| InChI | InChI=1S/C10H22O2.C10H22O/c1-3-6-9(2)7-4-5-8-10(11)12;1-3-7-10(2)8-5-4-6-9-11/h9-12H,3-8H2,1-2H3;10-11H,3-9H2,1-2H3 |
| InChIKey | PGKSRDZVZZPSMP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-methylnonane-1,1-diol;6-methylnonan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylnonane-1,1-diol;6-methylnonan-1-ol?
The IUPAC name of 6-methylnonane-1,1-diol;6-methylnonan-1-ol (CID 90947369) is 6-methylnonane-1,1-diol;6-methylnonan-1-ol.
What is the SMILES notation for 6-methylnonane-1,1-diol;6-methylnonan-1-ol?
The canonical SMILES for 6-methylnonane-1,1-diol;6-methylnonan-1-ol is CCCC(C)CCCCC(O)O.CCCC(C)CCCCCO.
What is the InChIKey of 6-methylnonane-1,1-diol;6-methylnonan-1-ol?
The InChIKey is PGKSRDZVZZPSMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O2.C10H22O/c1-3-6-9(2)7-4-5-8-10(11)12;1-3-7-10(2)8-5-4-6-9-11/h9-12H,3-8H2,1-2H3;10-11H,3-9H2,1-2H3.
What are the key properties of 6-methylnonane-1,1-diol;6-methylnonan-1-ol?
6-methylnonane-1,1-diol;6-methylnonan-1-ol has a molecular weight of 332.57 g/mol, XLogP of 5.27, 14 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylnonane-1,1-diol;6-methylnonan-1-ol is sourced from PubChem (CID 90947369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).