About 4-methylheptan-1-ol;nonan-3-ol
4-methylheptan-1-ol;nonan-3-ol (PubChem CID 135150427) has the molecular formula C17H38O2
and a molecular weight of 274.49 g/mol. Its IUPAC name is 4-methylheptan-1-ol;nonan-3-ol.
Molecular Properties
| Compound Name | 4-methylheptan-1-ol;nonan-3-ol |
| PubChem CID | 135150427 |
| Molecular Formula | C17H38O2 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.29 |
| IUPAC Name | 4-methylheptan-1-ol;nonan-3-ol |
| SMILES | CCCC(C)CCCO.CCCCCCC(O)CC |
| InChI | InChI=1S/C9H20O.C8H18O/c1-3-5-6-7-8-9(10)4-2;1-3-5-8(2)6-4-7-9/h9-10H,3-8H2,1-2H3;8-9H,3-7H2,1-2H3 |
| InChIKey | PTBOJQIHSKQYAA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methylheptan-1-ol;nonan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylheptan-1-ol;nonan-3-ol?
The IUPAC name of 4-methylheptan-1-ol;nonan-3-ol (CID 135150427) is 4-methylheptan-1-ol;nonan-3-ol.
What is the SMILES notation for 4-methylheptan-1-ol;nonan-3-ol?
The canonical SMILES for 4-methylheptan-1-ol;nonan-3-ol is CCCC(C)CCCO.CCCCCCC(O)CC.
What is the InChIKey of 4-methylheptan-1-ol;nonan-3-ol?
The InChIKey is PTBOJQIHSKQYAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O.C8H18O/c1-3-5-6-7-8-9(10)4-2;1-3-5-8(2)6-4-7-9/h9-10H,3-8H2,1-2H3;8-9H,3-7H2,1-2H3.
What are the key properties of 4-methylheptan-1-ol;nonan-3-ol?
4-methylheptan-1-ol;nonan-3-ol has a molecular weight of 274.49 g/mol, XLogP of 4.92, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylheptan-1-ol;nonan-3-ol is sourced from PubChem (CID 135150427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).