About acetic acid;9-methyldodecan-1-ol
acetic acid;9-methyldodecan-1-ol (PubChem CID 71407240) has the molecular formula C15H32O3
and a molecular weight of 260.42 g/mol. Its IUPAC name is acetic acid;9-methyldodecan-1-ol.
Molecular Properties
| Compound Name | acetic acid;9-methyldodecan-1-ol |
| PubChem CID | 71407240 |
| Molecular Formula | C15H32O3 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.24 |
| IUPAC Name | acetic acid;9-methyldodecan-1-ol |
| SMILES | CC(=O)O.CCCC(C)CCCCCCCCO |
| InChI | InChI=1S/C13H28O.C2H4O2/c1-3-10-13(2)11-8-6-4-5-7-9-12-14;1-2(3)4/h13-14H,3-12H2,1-2H3;1H3,(H,3,4) |
| InChIKey | CLEHRSQINUQVQP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;9-methyldodecan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;9-methyldodecan-1-ol?
The IUPAC name of acetic acid;9-methyldodecan-1-ol (CID 71407240) is acetic acid;9-methyldodecan-1-ol.
What is the SMILES notation for acetic acid;9-methyldodecan-1-ol?
The canonical SMILES for acetic acid;9-methyldodecan-1-ol is CC(=O)O.CCCC(C)CCCCCCCCO.
What is the InChIKey of acetic acid;9-methyldodecan-1-ol?
The InChIKey is CLEHRSQINUQVQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O.C2H4O2/c1-3-10-13(2)11-8-6-4-5-7-9-12-14;1-2(3)4/h13-14H,3-12H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;9-methyldodecan-1-ol?
acetic acid;9-methyldodecan-1-ol has a molecular weight of 260.42 g/mol, XLogP of 4.24, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;9-methyldodecan-1-ol is sourced from PubChem (CID 71407240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).