C22H44N2O2 — CID 167061111
N-hexyl-N'-(7-methyldecyl)pentanediamide (PubChem CID 167061111) has the molecular formula C22H44N2O2 and a molecular weight of 368.61 g/mol. Its IUPAC name is N-hexyl-N'-(7-methyldecyl)pentanediamide.
| Compound Name | N-hexyl-N'-(7-methyldecyl)pentanediamide |
|---|---|
| PubChem CID | 167061111 |
| Molecular Formula | C22H44N2O2 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.34 |
| IUPAC Name | N-hexyl-N'-(7-methyldecyl)pentanediamide |
| SMILES | CCCCCCNC(=O)CCCC(=O)NCCCCCCC(C)CCC |
| InChI | InChI=1S/C22H44N2O2/c1-4-6-7-11-18-23-21(25)16-13-17-22(26)24-19-12-9-8-10-15-20(3)14-5-2/h20H,4-19H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | QIYLUZBEJIKYTQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|