C9H15F5N2O3S — CID 58855518
1,1,2,2,2-pentafluoro-N-methyl-N-(2-morpholin-4-ylethyl)ethanesulfonamide (PubChem CID 58855518) has the molecular formula C9H15F5N2O3S and a molecular weight of 326.29 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoro-N-methyl-N-(2-morpholin-4-ylethyl)ethanesulfonamide.
| Compound Name | 1,1,2,2,2-pentafluoro-N-methyl-N-(2-morpholin-4-ylethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 58855518 |
| Molecular Formula | C9H15F5N2O3S |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 1,1,2,2,2-pentafluoro-N-methyl-N-(2-morpholin-4-ylethyl)ethanesulfonamide |
| SMILES | CN(CCN1CCOCC1)S(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H15F5N2O3S/c1-15(2-3-16-4-6-19-7-5-16)20(17,18)9(13,14)8(10,11)12/h2-7H2,1H3 |
| InChIKey | HJXWWJDCKXAIFL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|