C12H23NO5S — CID 82183293
2-ethyl-2-(2-morpholin-4-ylethylsulfonyl)butanoic acid (PubChem CID 82183293) has the molecular formula C12H23NO5S and a molecular weight of 293.38 g/mol. Its IUPAC name is 2-ethyl-2-(2-morpholin-4-ylethylsulfonyl)butanoic acid.
| Compound Name | 2-ethyl-2-(2-morpholin-4-ylethylsulfonyl)butanoic acid |
|---|---|
| PubChem CID | 82183293 |
| Molecular Formula | C12H23NO5S |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-ethyl-2-(2-morpholin-4-ylethylsulfonyl)butanoic acid |
| SMILES | CCC(CC)(C(=O)O)S(=O)(=O)CCN1CCOCC1 |
| InChI | InChI=1S/C12H23NO5S/c1-3-12(4-2,11(14)15)19(16,17)10-7-13-5-8-18-9-6-13/h3-10H2,1-2H3,(H,14,15) |
| InChIKey | ULPNMRRIFOHWIF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |