C8H15NO5S — CID 42035723
(2S)-2-methyl-3-morpholin-4-ylsulfonylpropanoic acid (PubChem CID 42035723) has the molecular formula C8H15NO5S and a molecular weight of 237.28 g/mol. Its IUPAC name is (2S)-2-methyl-3-morpholin-4-ylsulfonylpropanoic acid.
| Compound Name | (2S)-2-methyl-3-morpholin-4-ylsulfonylpropanoic acid |
|---|---|
| PubChem CID | 42035723 |
| Molecular Formula | C8H15NO5S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | (2S)-2-methyl-3-morpholin-4-ylsulfonylpropanoic acid |
| SMILES | C[C@H](CS(=O)(=O)N1CCOCC1)C(=O)O |
| InChI | InChI=1S/C8H15NO5S/c1-7(8(10)11)6-15(12,13)9-2-4-14-5-3-9/h7H,2-6H2,1H3,(H,10,11)/t7-/m1/s1 |
| InChIKey | QZUHGVKERSZDAT-SSDOTTSWSA-N |
| XLogP | -0.63 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |