C12H25NO — CID 79063676
4-(diethylamino)-2,4-dimethylhexan-3-one (PubChem CID 79063676) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is 4-(diethylamino)-2,4-dimethylhexan-3-one.
| Compound Name | 4-(diethylamino)-2,4-dimethylhexan-3-one |
|---|---|
| PubChem CID | 79063676 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 4-(diethylamino)-2,4-dimethylhexan-3-one |
| SMILES | CCN(CC)C(C)(CC)C(=O)C(C)C |
| InChI | InChI=1S/C12H25NO/c1-7-12(6,11(14)10(4)5)13(8-2)9-3/h10H,7-9H2,1-6H3 |
| InChIKey | HTFBIOKLIFSPCG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |