C14H24O2 — CID 44720477
5-hydroxy-2,4,4-trimethyl-5-prop-2-enyloct-7-en-3-one (PubChem CID 44720477) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 5-hydroxy-2,4,4-trimethyl-5-prop-2-enyloct-7-en-3-one.
| Compound Name | 5-hydroxy-2,4,4-trimethyl-5-prop-2-enyloct-7-en-3-one |
|---|---|
| PubChem CID | 44720477 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 5-hydroxy-2,4,4-trimethyl-5-prop-2-enyloct-7-en-3-one |
| SMILES | C=CCC(O)(CC=C)C(C)(C)C(=O)C(C)C |
| InChI | InChI=1S/C14H24O2/c1-7-9-14(16,10-8-2)13(5,6)12(15)11(3)4/h7-8,11,16H,1-2,9-10H2,3-6H3 |
| InChIKey | GCWLXXLPYSKYOO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|