C15H29NO — CID 90351471
2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one (PubChem CID 90351471) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is 2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one.
| Compound Name | 2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one |
|---|---|
| PubChem CID | 90351471 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | 2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one |
| SMILES | C=CCCCC(C)(C(=O)C(C)C)N(C)C(C)C |
| InChI | InChI=1S/C15H29NO/c1-8-9-10-11-15(6,14(17)12(2)3)16(7)13(4)5/h8,12-13H,1,9-11H2,2-7H3 |
| InChIKey | ZYWIIVHSARXTIY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|