C10H19NO — CID 89146514
(2S)-N,N,2-trimethylhept-6-enamide (PubChem CID 89146514) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (2S)-N,N,2-trimethylhept-6-enamide.
| Compound Name | (2S)-N,N,2-trimethylhept-6-enamide |
|---|---|
| PubChem CID | 89146514 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (2S)-N,N,2-trimethylhept-6-enamide |
| SMILES | C=CCCC[C@H](C)C(=O)N(C)C |
| InChI | InChI=1S/C10H19NO/c1-5-6-7-8-9(2)10(12)11(3)4/h5,9H,1,6-8H2,2-4H3/t9-/m0/s1 |
| InChIKey | KGWYIWNPSLSXCF-VIFPVBQESA-N |
| XLogP | 2.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|