C9H17NO2 — CID 134872524
(2R,4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide (PubChem CID 134872524) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (2R,4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide.
| Compound Name | (2R,4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide |
|---|---|
| PubChem CID | 134872524 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (2R,4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide |
| SMILES | C=C[C@@H](O)C[C@@H](C)C(=O)N(C)C |
| InChI | InChI=1S/C9H17NO2/c1-5-8(11)6-7(2)9(12)10(3)4/h5,7-8,11H,1,6H2,2-4H3/t7-,8-/m1/s1 |
| InChIKey | LMPMYEBOSLDTHM-HTQZYQBOSA-N |
| XLogP | 0.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|