C11H21NO — CID 150696751
(Z)-N,N,2-trimethyloct-5-enamide (PubChem CID 150696751) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (Z)-N,N,2-trimethyloct-5-enamide.
| Compound Name | (Z)-N,N,2-trimethyloct-5-enamide |
|---|---|
| PubChem CID | 150696751 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (Z)-N,N,2-trimethyloct-5-enamide |
| SMILES | CC/C=C\CCC(C)C(=O)N(C)C |
| InChI | InChI=1S/C11H21NO/c1-5-6-7-8-9-10(2)11(13)12(3)4/h6-7,10H,5,8-9H2,1-4H3/b7-6- |
| InChIKey | JKZUAYPQTOVCJC-SREVYHEPSA-N |
| XLogP | 2.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|