C12H20BrNO2 — CID 11033580
(E)-2-bromo-N,N-dimethyl-3-oxodec-7-enamide (PubChem CID 11033580) has the molecular formula C12H20BrNO2 and a molecular weight of 290.20 g/mol. Its IUPAC name is (E)-2-bromo-N,N-dimethyl-3-oxodec-7-enamide.
| Compound Name | (E)-2-bromo-N,N-dimethyl-3-oxodec-7-enamide |
|---|---|
| PubChem CID | 11033580 |
| Molecular Formula | C12H20BrNO2 |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | (E)-2-bromo-N,N-dimethyl-3-oxodec-7-enamide |
| SMILES | CC/C=C/CCCC(=O)C(Br)C(=O)N(C)C |
| InChI | InChI=1S/C12H20BrNO2/c1-4-5-6-7-8-9-10(15)11(13)12(16)14(2)3/h5-6,11H,4,7-9H2,1-3H3/b6-5+ |
| InChIKey | MBFCTMAGJALDDB-AATRIKPKSA-N |
| XLogP | 2.54 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|